C23H25ClN4O3 — CID 143256664
2-[3-[3-butyl-5-[1-(3-chloro-2-hydroxyanilino)ethenylamino]pyrazol-1-yl]phenyl]acetic acid (PubChem CID 143256664) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 2-[3-[3-butyl-5-[1-(3-chloro-2-hydroxyanilino)ethenylamino]pyrazol-1-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[3-butyl-5-[1-(3-chloro-2-hydroxyanilino)ethenylamino]pyrazol-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 143256664 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[3-[3-butyl-5-[1-(3-chloro-2-hydroxyanilino)ethenylamino]pyrazol-1-yl]phenyl]acetic acid |
| SMILES | C=C(Nc1cccc(Cl)c1O)Nc1cc(CCCC)nn1-c1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C23H25ClN4O3/c1-3-4-8-17-14-21(26-15(2)25-20-11-6-10-19(24)23(20)31)28(27-17)18-9-5-7-16(12-18)13-22(29)30/h5-7,9-12,14,25-26,31H,2-4,8,13H2,1H3,(H,29,30) |
| InChIKey | FVVWIKUMPLPETO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|