C22H21N5O3 — CID 143256519
1-(1,3-benzodioxol-5-yl)-3-[3-butyl-1-(3-cyanophenyl)pyrazol-5-yl]urea (PubChem CID 143256519) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[3-butyl-1-(3-cyanophenyl)pyrazol-5-yl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[3-butyl-1-(3-cyanophenyl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 143256519 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[3-butyl-1-(3-cyanophenyl)pyrazol-5-yl]urea |
| SMILES | CCCCc1cc(NC(=O)Nc2ccc3c(c2)OCO3)n(-c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C22H21N5O3/c1-2-3-6-17-12-21(27(26-17)18-7-4-5-15(10-18)13-23)25-22(28)24-16-8-9-19-20(11-16)30-14-29-19/h4-5,7-12H,2-3,6,14H2,1H3,(H2,24,25,28) |
| InChIKey | ZNMTZRCXQFJGMZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 101.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |