C28H33F3N4O7S — CID 143257582
[(3S)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-(furan-3-yl)pyrrolidin-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 143257582) has the molecular formula C28H33F3N4O7S and a molecular weight of 626.65 g/mol. Its IUPAC name is [(3S)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-(furan-3-yl)pyrrolidin-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3S)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-(furan-3-yl)pyrrolidin-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143257582 |
| Molecular Formula | C28H33F3N4O7S |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | [(3S)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-(furan-3-yl)pyrrolidin-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)[C@@H]3CN(S(=O)(=O)c4c(C)noc4C)CC3c3ccoc3)CC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H32N4O5S.C2HF3O2/c1-17-5-6-18(2)24(13-17)28-8-10-29(11-9-28)26(31)23-15-30(14-22(23)21-7-12-34-16-21)36(32,33)25-19(3)27-35-20(25)4;3-2(4,5)1(6)7/h5-7,12-13,16,22-23H,8-11,14-15H2,1-4H3;(H,6,7)/t22?,23-;/m1./s1 |
| InChIKey | DWNDMWIYDXGRSZ-DBCZNGTMSA-N |
| XLogP | 3.89 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |