C27H35N5O5S — CID 59666126
[(4R)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]pyrrolidin-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 59666126) has the molecular formula C27H35N5O5S and a molecular weight of 541.67 g/mol. Its IUPAC name is [(4R)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]pyrrolidin-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | [(4R)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]pyrrolidin-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 59666126 |
| Molecular Formula | C27H35N5O5S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | [(4R)-4-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]pyrrolidin-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)C3CN(S(=O)(=O)c4c(C)noc4C)C[C@H]3c3c(C)noc3C)CC2)c1 |
| InChI | InChI=1S/C27H35N5O5S/c1-16-7-8-17(2)24(13-16)30-9-11-31(12-10-30)27(33)23-15-32(14-22(23)25-18(3)28-36-20(25)5)38(34,35)26-19(4)29-37-21(26)6/h7-8,13,22-23H,9-12,14-15H2,1-6H3/t22-,23?/m1/s1 |
| InChIKey | RQBANXRZGMOQKV-WTQRLHSKSA-N |
| XLogP | 3.27 |
| TPSA | 112.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |