About butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane
butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane (PubChem CID 143257764) has the molecular formula C25H39NO2
and a molecular weight of 385.59 g/mol. Its IUPAC name is butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane.
Molecular Properties
| Compound Name | butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane |
| PubChem CID | 143257764 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane |
| SMILES | CCC.CCCC.CCCc1ccc(Oc2ccc(C=O)cn2)cc1CCC |
| InChI | InChI=1S/C18H21NO2.C4H10.C3H8/c1-3-5-15-8-9-17(11-16(15)6-4-2)21-18-10-7-14(13-20)12-19-18;1-3-4-2;1-3-2/h7-13H,3-6H2,1-2H3;3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | ZKMADZIPDVPPAS-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane?
The IUPAC name of butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane (CID 143257764) is butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane.
What is the SMILES notation for butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane?
The canonical SMILES for butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane is CCC.CCCC.CCCc1ccc(Oc2ccc(C=O)cn2)cc1CCC.
What is the InChIKey of butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane?
The InChIKey is ZKMADZIPDVPPAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2.C4H10.C3H8/c1-3-5-15-8-9-17(11-16(15)6-4-2)21-18-10-7-14(13-20)12-19-18;1-3-4-2;1-3-2/h7-13H,3-6H2,1-2H3;3-4H2,1-2H3;3H2,1-2H3.
What are the key properties of butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane?
butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane has a molecular weight of 385.59 g/mol, XLogP of 7.81, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;6-(3,4-dipropylphenoxy)pyridine-3-carbaldehyde;propane is sourced from PubChem (CID 143257764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).