C19H19FN4O2 — CID 143258587
ethane;5-[(4-fluorobenzoyl)amino]-1-phenylpyrazole-4-carboxamide (PubChem CID 143258587) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is ethane;5-[(4-fluorobenzoyl)amino]-1-phenylpyrazole-4-carboxamide.
| Compound Name | ethane;5-[(4-fluorobenzoyl)amino]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 143258587 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | ethane;5-[(4-fluorobenzoyl)amino]-1-phenylpyrazole-4-carboxamide |
| SMILES | CC.NC(=O)c1cnn(-c2ccccc2)c1NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN4O2.C2H6/c18-12-8-6-11(7-9-12)17(24)21-16-14(15(19)23)10-20-22(16)13-4-2-1-3-5-13;1-2/h1-10H,(H2,19,23)(H,21,24);1-2H3 |
| InChIKey | IJWSTHSZANREDP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |