C28H37NO5 — CID 143259935
(E)-4-[2-[[3-(2-methoxy-5-methylphenyl)-4-phenylbutyl]-propan-2-ylamino]propoxy]-4-oxobut-2-enoic acid (PubChem CID 143259935) has the molecular formula C28H37NO5 and a molecular weight of 467.61 g/mol. Its IUPAC name is (E)-4-[2-[[3-(2-methoxy-5-methylphenyl)-4-phenylbutyl]-propan-2-ylamino]propoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-[[3-(2-methoxy-5-methylphenyl)-4-phenylbutyl]-propan-2-ylamino]propoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 143259935 |
| Molecular Formula | C28H37NO5 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | (E)-4-[2-[[3-(2-methoxy-5-methylphenyl)-4-phenylbutyl]-propan-2-ylamino]propoxy]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(C)cc1C(CCN(C(C)C)C(C)COC(=O)/C=C/C(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C28H37NO5/c1-20(2)29(22(4)19-34-28(32)14-13-27(30)31)16-15-24(18-23-9-7-6-8-10-23)25-17-21(3)11-12-26(25)33-5/h6-14,17,20,22,24H,15-16,18-19H2,1-5H3,(H,30,31)/b14-13+ |
| InChIKey | UGGCVUBPYSLFOX-BUHFOSPRSA-N |
| XLogP | 5.00 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|