C18H31NO — CID 143260673
1-hydroxy-2,2,4,6,6-pentamethylpiperidine;1,3-xylene (PubChem CID 143260673) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 1-hydroxy-2,2,4,6,6-pentamethylpiperidine;1,3-xylene.
| Compound Name | 1-hydroxy-2,2,4,6,6-pentamethylpiperidine;1,3-xylene |
|---|---|
| PubChem CID | 143260673 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 1-hydroxy-2,2,4,6,6-pentamethylpiperidine;1,3-xylene |
| SMILES | CC1CC(C)(C)N(O)C(C)(C)C1.Cc1cccc(C)c1 |
| InChI | InChI=1S/C10H21NO.C8H10/c1-8-6-9(2,3)11(12)10(4,5)7-8;1-7-4-3-5-8(2)6-7/h8,12H,6-7H2,1-5H3;3-6H,1-2H3 |
| InChIKey | LGCRGKZMMPLQDO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |