C16H20N4O2S — CID 143260983
methyl N'-[(E)-2-amino-1-hydroxy-2-[2-[(5-methylfuran-2-yl)methylamino]phenyl]ethenyl]carbamimidothioate (PubChem CID 143260983) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is methyl N'-[(E)-2-amino-1-hydroxy-2-[2-[(5-methylfuran-2-yl)methylamino]phenyl]ethenyl]carbamimidothioate.
| Compound Name | methyl N'-[(E)-2-amino-1-hydroxy-2-[2-[(5-methylfuran-2-yl)methylamino]phenyl]ethenyl]carbamimidothioate |
|---|---|
| PubChem CID | 143260983 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl N'-[(E)-2-amino-1-hydroxy-2-[2-[(5-methylfuran-2-yl)methylamino]phenyl]ethenyl]carbamimidothioate |
| SMILES | CS/C(N)=N/C(O)=C(\N)c1ccccc1NCc1ccc(C)o1 |
| InChI | InChI=1S/C16H20N4O2S/c1-10-7-8-11(22-10)9-19-13-6-4-3-5-12(13)14(17)15(21)20-16(18)23-2/h3-8,19,21H,9,17H2,1-2H3,(H2,18,20)/b15-14+ |
| InChIKey | JICNMMIMDUTNLZ-CCEZHUSRSA-N |
| XLogP | 3.02 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|