About ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene
ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene (PubChem CID 143261188) has the molecular formula C31H64
and a molecular weight of 436.85 g/mol. Its IUPAC name is ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene.
Molecular Properties
| Compound Name | ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene |
| PubChem CID | 143261188 |
| Molecular Formula | C31H64 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.50 |
| IUPAC Name | ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene |
| SMILES | C=C(/C=C(\CC)CC(C)C)CC.C=CCCCCC(=C)CCCCC.CC.CC.CC |
| InChI | InChI=1S/C13H24.C12H22.3C2H6/c1-4-6-8-10-12-13(3)11-9-7-5-2;1-6-11(5)9-12(7-2)8-10(3)4;3*1-2/h4H,1,3,5-12H2,2H3;9-10H,5-8H2,1-4H3;3*1-2H3/b;12-9+;;; |
| InChIKey | BAMQSHHXYXXTBF-RJWFDVDNSA-N |
| XLogP | 12.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene?
The IUPAC name of ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene (CID 143261188) is ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene.
What is the SMILES notation for ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene?
The canonical SMILES for ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene is C=C(/C=C(\CC)CC(C)C)CC.C=CCCCCC(=C)CCCCC.CC.CC.CC.
What is the InChIKey of ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene?
The InChIKey is BAMQSHHXYXXTBF-RJWFDVDNSA-N. The full InChI is InChI=1S/C13H24.C12H22.3C2H6/c1-4-6-8-10-12-13(3)11-9-7-5-2;1-6-11(5)9-12(7-2)8-10(3)4;3*1-2/h4H,1,3,5-12H2,2H3;9-10H,5-8H2,1-4H3;3*1-2H3/b;12-9+;;;.
What are the key properties of ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene?
ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene has a molecular weight of 436.85 g/mol, XLogP of 12.28, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-4-ethyl-2-methyl-6-methylideneoct-4-ene;7-methylidenedodec-1-ene is sourced from PubChem (CID 143261188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).