2-cyclobutylacetyl chloride

C6H9ClO — CID 14326266

IUPAC2-cyclobutylacetyl chloride
SMILESO=C(Cl)CC1CCC1
InChIInChI=1S/C6H9ClO/c7-6(8)4-5-2-1-3-5/h5H,1-4H2
InChIKeyZTICGZOOKCTTML-UHFFFAOYSA-N
MW132.59 g/mol
LogP1.94
Rot. Bonds2

About 2-cyclobutylacetyl chloride

2-cyclobutylacetyl chloride (PubChem CID 14326266) has the molecular formula C6H9ClO and a molecular weight of 132.59 g/mol. Its IUPAC name is 2-cyclobutylacetyl chloride.

Molecular Properties

Compound Name2-cyclobutylacetyl chloride
PubChem CID14326266
Molecular FormulaC6H9ClO
Molecular Weight132.59 g/mol
Exact Mass132.03
IUPAC Name2-cyclobutylacetyl chloride
SMILESO=C(Cl)CC1CCC1
InChIInChI=1S/C6H9ClO/c7-6(8)4-5-2-1-3-5/h5H,1-4H2
InChIKeyZTICGZOOKCTTML-UHFFFAOYSA-N
XLogP1.94
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.59
LogP ≤ 51.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-cyclobutylacetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclobutylacetyl chloride?
The IUPAC name of 2-cyclobutylacetyl chloride (CID 14326266) is 2-cyclobutylacetyl chloride.
What is the SMILES notation for 2-cyclobutylacetyl chloride?
The canonical SMILES for 2-cyclobutylacetyl chloride is O=C(Cl)CC1CCC1.
What is the InChIKey of 2-cyclobutylacetyl chloride?
The InChIKey is ZTICGZOOKCTTML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO/c7-6(8)4-5-2-1-3-5/h5H,1-4H2.
What are the key properties of 2-cyclobutylacetyl chloride?
2-cyclobutylacetyl chloride has a molecular weight of 132.59 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylacetyl chloride is sourced from PubChem (CID 14326266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).