C12H19FO3 — CID 143263376
(E,3Z)-3-(1-fluoroethylidene)-4-(2-methoxyethoxy)hept-4-en-2-one (PubChem CID 143263376) has the molecular formula C12H19FO3 and a molecular weight of 230.28 g/mol. Its IUPAC name is (E,3Z)-3-(1-fluoroethylidene)-4-(2-methoxyethoxy)hept-4-en-2-one.
| Compound Name | (E,3Z)-3-(1-fluoroethylidene)-4-(2-methoxyethoxy)hept-4-en-2-one |
|---|---|
| PubChem CID | 143263376 |
| Molecular Formula | C12H19FO3 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (E,3Z)-3-(1-fluoroethylidene)-4-(2-methoxyethoxy)hept-4-en-2-one |
| SMILES | CC/C=C(OCCOC)\C(C(C)=O)=C(/C)F |
| InChI | InChI=1S/C12H19FO3/c1-5-6-11(16-8-7-15-4)12(9(2)13)10(3)14/h6H,5,7-8H2,1-4H3/b11-6+,12-9+ |
| InChIKey | NJXHJGOCZMDPQA-MOPWJCKASA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|