C13H22O2 — CID 143829780
ethane;(3E,4E)-4-ethoxy-3-ethylidenehepta-4,6-dien-2-one (PubChem CID 143829780) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is ethane;(3E,4E)-4-ethoxy-3-ethylidenehepta-4,6-dien-2-one.
| Compound Name | ethane;(3E,4E)-4-ethoxy-3-ethylidenehepta-4,6-dien-2-one |
|---|---|
| PubChem CID | 143829780 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | ethane;(3E,4E)-4-ethoxy-3-ethylidenehepta-4,6-dien-2-one |
| SMILES | C=C/C=C(OCC)\C(=C/C)C(C)=O.CC |
| InChI | InChI=1S/C11H16O2.C2H6/c1-5-8-11(13-7-3)10(6-2)9(4)12;1-2/h5-6,8H,1,7H2,2-4H3;1-2H3/b10-6-,11-8+; |
| InChIKey | IRMLLWFKRPFPDV-KWHCWSKKSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|