C22H24F4N4O2 — CID 143263702
4-[(2,6-difluorobenzoyl)amino]-N-[(2E,4Z)-3-fluoro-2-(fluoromethyl)octa-2,4,7-trienyl]-1H-pyrazole-5-carboxamide;ethane (PubChem CID 143263702) has the molecular formula C22H24F4N4O2 and a molecular weight of 452.45 g/mol. Its IUPAC name is 4-[(2,6-difluorobenzoyl)amino]-N-[(2E,4Z)-3-fluoro-2-(fluoromethyl)octa-2,4,7-trienyl]-1H-pyrazole-5-carboxamide;ethane.
| Compound Name | 4-[(2,6-difluorobenzoyl)amino]-N-[(2E,4Z)-3-fluoro-2-(fluoromethyl)octa-2,4,7-trienyl]-1H-pyrazole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 143263702 |
| Molecular Formula | C22H24F4N4O2 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 4-[(2,6-difluorobenzoyl)amino]-N-[(2E,4Z)-3-fluoro-2-(fluoromethyl)octa-2,4,7-trienyl]-1H-pyrazole-5-carboxamide;ethane |
| SMILES | C=CC/C=C\C(F)=C(/CF)CNC(=O)c1[nH]ncc1NC(=O)c1c(F)cccc1F.CC |
| InChI | InChI=1S/C20H18F4N4O2.C2H6/c1-2-3-4-6-13(22)12(9-21)10-25-20(30)18-16(11-26-28-18)27-19(29)17-14(23)7-5-8-15(17)24;1-2/h2,4-8,11H,1,3,9-10H2,(H,25,30)(H,26,28)(H,27,29);1-2H3/b6-4-,13-12-; |
| InChIKey | HRGSONMRJGZPFI-DKULQSDUSA-N |
| XLogP | 5.02 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|