C23H24F2N6O2 — CID 59733451
4-[(2,6-difluorobenzoyl)amino]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1H-pyrazole-5-carboxamide (PubChem CID 59733451) has the molecular formula C23H24F2N6O2 and a molecular weight of 454.48 g/mol. Its IUPAC name is 4-[(2,6-difluorobenzoyl)amino]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[(2,6-difluorobenzoyl)amino]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59733451 |
| Molecular Formula | C23H24F2N6O2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4-[(2,6-difluorobenzoyl)amino]-N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1H-pyrazole-5-carboxamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)c3[nH]ncc3NC(=O)c3c(F)cccc3F)cc2)CC1 |
| InChI | InChI=1S/C23H24F2N6O2/c1-30-9-11-31(12-10-30)16-7-5-15(6-8-16)13-26-23(33)21-19(14-27-29-21)28-22(32)20-17(24)3-2-4-18(20)25/h2-8,14H,9-13H2,1H3,(H,26,33)(H,27,29)(H,28,32) |
| InChIKey | CJYRYTFXYQSRKX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|