C38H38N8O2 — CID 69045893
N,4-diphenyl-1H-pyrazole-5-carboxamide;N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 69045893) has the molecular formula C38H38N8O2 and a molecular weight of 638.78 g/mol. Its IUPAC name is N,4-diphenyl-1H-pyrazole-5-carboxamide;N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N,4-diphenyl-1H-pyrazole-5-carboxamide;N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69045893 |
| Molecular Formula | C38H38N8O2 |
| Molecular Weight | 638.78 g/mol |
| Exact Mass | 638.31 |
| IUPAC Name | N,4-diphenyl-1H-pyrazole-5-carboxamide;N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-4-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)c3[nH]ncc3-c3ccccc3)cc2)CC1.O=C(Nc1ccccc1)c1[nH]ncc1-c1ccccc1 |
| InChI | InChI=1S/C22H25N5O.C16H13N3O/c1-26-11-13-27(14-12-26)19-9-7-17(8-10-19)15-23-22(28)21-20(16-24-25-21)18-5-3-2-4-6-18;20-16(18-13-9-5-2-6-10-13)15-14(11-17-19-15)12-7-3-1-4-8-12/h2-10,16H,11-15H2,1H3,(H,23,28)(H,24,25);1-11H,(H,17,19)(H,18,20) |
| InChIKey | WNHCFZNARVXNHY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.78 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|