C25H26F2N4O2 — CID 58094701
2,6-difluoro-N-[5-[3-[4-(4-methylpiperazin-1-yl)phenyl]propanoyl]-2H-pyrrol-4-yl]benzamide (PubChem CID 58094701) has the molecular formula C25H26F2N4O2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2,6-difluoro-N-[5-[3-[4-(4-methylpiperazin-1-yl)phenyl]propanoyl]-2H-pyrrol-4-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[5-[3-[4-(4-methylpiperazin-1-yl)phenyl]propanoyl]-2H-pyrrol-4-yl]benzamide |
|---|---|
| PubChem CID | 58094701 |
| Molecular Formula | C25H26F2N4O2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 2,6-difluoro-N-[5-[3-[4-(4-methylpiperazin-1-yl)phenyl]propanoyl]-2H-pyrrol-4-yl]benzamide |
| SMILES | CN1CCN(c2ccc(CCC(=O)C3=NCC=C3NC(=O)c3c(F)cccc3F)cc2)CC1 |
| InChI | InChI=1S/C25H26F2N4O2/c1-30-13-15-31(16-14-30)18-8-5-17(6-9-18)7-10-22(32)24-21(11-12-28-24)29-25(33)23-19(26)3-2-4-20(23)27/h2-6,8-9,11H,7,10,12-16H2,1H3,(H,29,33) |
| InChIKey | PKTWJESPTBBTNY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|