C19H20F2N2O2 — CID 59156534
N-[5-(2-cyclohexylacetyl)-2H-pyrrol-4-yl]-2,6-difluorobenzamide (PubChem CID 59156534) has the molecular formula C19H20F2N2O2 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[5-(2-cyclohexylacetyl)-2H-pyrrol-4-yl]-2,6-difluorobenzamide.
| Compound Name | N-[5-(2-cyclohexylacetyl)-2H-pyrrol-4-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 59156534 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[5-(2-cyclohexylacetyl)-2H-pyrrol-4-yl]-2,6-difluorobenzamide |
| SMILES | O=C(CC1CCCCC1)C1=NCC=C1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C19H20F2N2O2/c20-13-7-4-8-14(21)17(13)19(25)23-15-9-10-22-18(15)16(24)11-12-5-2-1-3-6-12/h4,7-9,12H,1-3,5-6,10-11H2,(H,23,25) |
| InChIKey | RIMPSRJYSFGJHR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |