C16H18Cl2N5O2+ — CID 143263793
4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-yl-1H-pyrazol-1-ium-3-carboxamide (PubChem CID 143263793) has the molecular formula C16H18Cl2N5O2+ and a molecular weight of 383.26 g/mol. Its IUPAC name is 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-yl-1H-pyrazol-1-ium-3-carboxamide.
| Compound Name | 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-yl-1H-pyrazol-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 143263793 |
| Molecular Formula | C16H18Cl2N5O2+ |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-[(2,6-dichlorobenzoyl)amino]-N-piperidin-4-yl-1H-pyrazol-1-ium-3-carboxamide |
| SMILES | O=C(NC1CCNCC1)C1=N[NH2+]C=C1NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H17Cl2N5O2/c17-10-2-1-3-11(18)13(10)15(24)22-12-8-20-23-14(12)16(25)21-9-4-6-19-7-5-9/h1-3,8-9,19H,4-7H2,(H,20,23)(H,21,25)(H,22,24)/p+1 |
| InChIKey | OVPNQJVDAFNBDN-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|