C19H22N2O5 — CID 143265869
3-(2,4-dimethoxypyrimidin-5-yl)-7-methoxy-4-methylchromen-2-one;ethane (PubChem CID 143265869) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 3-(2,4-dimethoxypyrimidin-5-yl)-7-methoxy-4-methylchromen-2-one;ethane.
| Compound Name | 3-(2,4-dimethoxypyrimidin-5-yl)-7-methoxy-4-methylchromen-2-one;ethane |
|---|---|
| PubChem CID | 143265869 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-(2,4-dimethoxypyrimidin-5-yl)-7-methoxy-4-methylchromen-2-one;ethane |
| SMILES | CC.COc1ccc2c(C)c(-c3cnc(OC)nc3OC)c(=O)oc2c1 |
| InChI | InChI=1S/C17H16N2O5.C2H6/c1-9-11-6-5-10(21-2)7-13(11)24-16(20)14(9)12-8-18-17(23-4)19-15(12)22-3;1-2/h5-8H,1-4H3;1-2H3 |
| InChIKey | QREYIMZNRKGINS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|