C16H35N4+ — CID 143268135
N-[3-(2-methylpyrrolidin-1-yl)propyl]-N'-(2-pyrrolidin-1-ium-1-ylethyl)ethane-1,2-diamine (PubChem CID 143268135) has the molecular formula C16H35N4+ and a molecular weight of 283.48 g/mol. Its IUPAC name is N-[3-(2-methylpyrrolidin-1-yl)propyl]-N'-(2-pyrrolidin-1-ium-1-ylethyl)ethane-1,2-diamine.
| Compound Name | N-[3-(2-methylpyrrolidin-1-yl)propyl]-N'-(2-pyrrolidin-1-ium-1-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 143268135 |
| Molecular Formula | C16H35N4+ |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | N-[3-(2-methylpyrrolidin-1-yl)propyl]-N'-(2-pyrrolidin-1-ium-1-ylethyl)ethane-1,2-diamine |
| SMILES | CC1CCCN1CCCNCCNCC[NH+]1CCCC1 |
| InChI | InChI=1S/C16H34N4/c1-16-6-4-13-20(16)14-5-7-17-8-9-18-10-15-19-11-2-3-12-19/h16-18H,2-15H2,1H3/p+1 |
| InChIKey | SFPMKYSOMPRPHJ-UHFFFAOYSA-O |
| XLogP | -0.28 |
| TPSA | 31.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|