C19H40N4OS — CID 143268147
N'-[3-[(2S)-2-methylpyrrolidin-1-yl]-1-methylsulfanyloxypropyl]-N-[3-[(2S)-2-methylpyrrolidin-1-yl]propyl]ethane-1,2-diamine (PubChem CID 143268147) has the molecular formula C19H40N4OS and a molecular weight of 372.62 g/mol. Its IUPAC name is N'-[3-[(2S)-2-methylpyrrolidin-1-yl]-1-methylsulfanyloxypropyl]-N-[3-[(2S)-2-methylpyrrolidin-1-yl]propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[(2S)-2-methylpyrrolidin-1-yl]-1-methylsulfanyloxypropyl]-N-[3-[(2S)-2-methylpyrrolidin-1-yl]propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 143268147 |
| Molecular Formula | C19H40N4OS |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | N'-[3-[(2S)-2-methylpyrrolidin-1-yl]-1-methylsulfanyloxypropyl]-N-[3-[(2S)-2-methylpyrrolidin-1-yl]propyl]ethane-1,2-diamine |
| SMILES | CSOC(CCN1CCC[C@@H]1C)NCCNCCCN1CCC[C@@H]1C |
| InChI | InChI=1S/C19H40N4OS/c1-17-7-4-13-22(17)15-6-10-20-11-12-21-19(24-25-3)9-16-23-14-5-8-18(23)2/h17-21H,4-16H2,1-3H3/t17-,18-,19?/m0/s1 |
| InChIKey | LFTDLUOSFVYGJQ-ADUPEVMXSA-N |
| XLogP | 2.54 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|