About 1-pyridin-4-ylethyl N-methylmethanimidate
1-pyridin-4-ylethyl N-methylmethanimidate (PubChem CID 143270127) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-pyridin-4-ylethyl N-methylmethanimidate.
Molecular Properties
| Compound Name | 1-pyridin-4-ylethyl N-methylmethanimidate |
| PubChem CID | 143270127 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-pyridin-4-ylethyl N-methylmethanimidate |
| SMILES | C/N=C/OC(C)c1ccncc1 |
| InChI | InChI=1S/C9H12N2O/c1-8(12-7-10-2)9-3-5-11-6-4-9/h3-8H,1-2H3/b10-7+ |
| InChIKey | MJIIPQVEQKIJNT-JXMROGBWSA-N |
| XLogP | 1.82 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-pyridin-4-ylethyl N-methylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-4-ylethyl N-methylmethanimidate?
The IUPAC name of 1-pyridin-4-ylethyl N-methylmethanimidate (CID 143270127) is 1-pyridin-4-ylethyl N-methylmethanimidate.
What is the SMILES notation for 1-pyridin-4-ylethyl N-methylmethanimidate?
The canonical SMILES for 1-pyridin-4-ylethyl N-methylmethanimidate is C/N=C/OC(C)c1ccncc1.
What is the InChIKey of 1-pyridin-4-ylethyl N-methylmethanimidate?
The InChIKey is MJIIPQVEQKIJNT-JXMROGBWSA-N. The full InChI is InChI=1S/C9H12N2O/c1-8(12-7-10-2)9-3-5-11-6-4-9/h3-8H,1-2H3/b10-7+.
What are the key properties of 1-pyridin-4-ylethyl N-methylmethanimidate?
1-pyridin-4-ylethyl N-methylmethanimidate has a molecular weight of 164.21 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-4-ylethyl N-methylmethanimidate is sourced from PubChem (CID 143270127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).