About 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate
1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate (PubChem CID 143270159) has the molecular formula C9H11BrN2O
and a molecular weight of 243.10 g/mol. Its IUPAC name is 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate.
Molecular Properties
| Compound Name | 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate |
| PubChem CID | 143270159 |
| Molecular Formula | C9H11BrN2O |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate |
| SMILES | C/N=C/OC(C)c1ccncc1Br |
| InChI | InChI=1S/C9H11BrN2O/c1-7(13-6-11-2)8-3-4-12-5-9(8)10/h3-7H,1-2H3/b11-6+ |
| InChIKey | RROYHSJHRLYOLT-IZZDOVSWSA-N |
| XLogP | 2.58 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate?
The IUPAC name of 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate (CID 143270159) is 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate.
What is the SMILES notation for 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate?
The canonical SMILES for 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate is C/N=C/OC(C)c1ccncc1Br.
What is the InChIKey of 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate?
The InChIKey is RROYHSJHRLYOLT-IZZDOVSWSA-N. The full InChI is InChI=1S/C9H11BrN2O/c1-7(13-6-11-2)8-3-4-12-5-9(8)10/h3-7H,1-2H3/b11-6+.
What are the key properties of 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate?
1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate has a molecular weight of 243.10 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromo-4-pyridinyl)ethyl N-methylmethanimidate is sourced from PubChem (CID 143270159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).