C21H30N2O2 — CID 143270163
(4E)-4-ethenyl-1-morpholin-4-yl-2-(1-phenylethylamino)hepta-4,6-dien-3-ol (PubChem CID 143270163) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (4E)-4-ethenyl-1-morpholin-4-yl-2-(1-phenylethylamino)hepta-4,6-dien-3-ol.
| Compound Name | (4E)-4-ethenyl-1-morpholin-4-yl-2-(1-phenylethylamino)hepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 143270163 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (4E)-4-ethenyl-1-morpholin-4-yl-2-(1-phenylethylamino)hepta-4,6-dien-3-ol |
| SMILES | C=C/C=C(\C=C)C(O)C(CN1CCOCC1)NC(C)c1ccccc1 |
| InChI | InChI=1S/C21H30N2O2/c1-4-9-18(5-2)21(24)20(16-23-12-14-25-15-13-23)22-17(3)19-10-7-6-8-11-19/h4-11,17,20-22,24H,1-2,12-16H2,3H3/b18-9+ |
| InChIKey | MPPOJEYCKMGBPA-GIJQJNRQSA-N |
| XLogP | 2.70 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|