C21H30Cl2N2O2 — CID 66646151
3-morpholin-4-yl-1-phenyl-2-[[(1S)-1-phenylethyl]amino]propan-1-ol;dihydrochloride (PubChem CID 66646151) has the molecular formula C21H30Cl2N2O2 and a molecular weight of 413.39 g/mol. Its IUPAC name is 3-morpholin-4-yl-1-phenyl-2-[[(1S)-1-phenylethyl]amino]propan-1-ol;dihydrochloride.
| Compound Name | 3-morpholin-4-yl-1-phenyl-2-[[(1S)-1-phenylethyl]amino]propan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 66646151 |
| Molecular Formula | C21H30Cl2N2O2 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-morpholin-4-yl-1-phenyl-2-[[(1S)-1-phenylethyl]amino]propan-1-ol;dihydrochloride |
| SMILES | C[C@H](NC(CN1CCOCC1)C(O)c1ccccc1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C21H28N2O2.2ClH/c1-17(18-8-4-2-5-9-18)22-20(16-23-12-14-25-15-13-23)21(24)19-10-6-3-7-11-19;;/h2-11,17,20-22,24H,12-16H2,1H3;2*1H/t17-,20?,21?;;/m0../s1 |
| InChIKey | UZHKZOZRNWBPKG-IMXOCYSMSA-N |
| XLogP | 3.62 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |