C12H16F3NS — CID 143270831
3-[(1Z,3E)-3-ethylsulfanyl-2-(trifluoromethyl)penta-1,3-dienyl]-2,5-dihydro-1H-pyrrole (PubChem CID 143270831) has the molecular formula C12H16F3NS and a molecular weight of 263.33 g/mol. Its IUPAC name is 3-[(1Z,3E)-3-ethylsulfanyl-2-(trifluoromethyl)penta-1,3-dienyl]-2,5-dihydro-1H-pyrrole.
| Compound Name | 3-[(1Z,3E)-3-ethylsulfanyl-2-(trifluoromethyl)penta-1,3-dienyl]-2,5-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 143270831 |
| Molecular Formula | C12H16F3NS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-[(1Z,3E)-3-ethylsulfanyl-2-(trifluoromethyl)penta-1,3-dienyl]-2,5-dihydro-1H-pyrrole |
| SMILES | C/C=C(SCC)\C(=C/C1=CCNC1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NS/c1-3-11(17-4-2)10(12(13,14)15)7-9-5-6-16-8-9/h3,5,7,16H,4,6,8H2,1-2H3/b10-7+,11-3+ |
| InChIKey | JNXDDROSAXVISC-LPLLPVNESA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|