C16H11N2O2S3- — CID 143271271
(5Z)-5-[[5-(oxidoamino)-2-phenylsulfanylphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 143271271) has the molecular formula C16H11N2O2S3- and a molecular weight of 359.48 g/mol. Its IUPAC name is (5Z)-5-[[5-(oxidoamino)-2-phenylsulfanylphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[5-(oxidoamino)-2-phenylsulfanylphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143271271 |
| Molecular Formula | C16H11N2O2S3- |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | (5Z)-5-[[5-(oxidoamino)-2-phenylsulfanylphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cc(N[O-])ccc1Sc1ccccc1 |
| InChI | InChI=1S/C16H11N2O2S3/c19-15-14(23-16(21)17-15)9-10-8-11(18-20)6-7-13(10)22-12-4-2-1-3-5-12/h1-9,18H,(H,17,19,21)/q-1/b14-9- |
| InChIKey | HVPWETYTQBDGJM-ZROIWOOFSA-N |
| XLogP | 4.24 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|