C21H21FN2O — CID 143271417
5-fluoro-N-[(1R)-1-propyl-2,3-dihydro-1H-inden-2-yl]-1H-indole-2-carboxamide (PubChem CID 143271417) has the molecular formula C21H21FN2O and a molecular weight of 336.41 g/mol. Its IUPAC name is 5-fluoro-N-[(1R)-1-propyl-2,3-dihydro-1H-inden-2-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-[(1R)-1-propyl-2,3-dihydro-1H-inden-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 143271417 |
| Molecular Formula | C21H21FN2O |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-fluoro-N-[(1R)-1-propyl-2,3-dihydro-1H-inden-2-yl]-1H-indole-2-carboxamide |
| SMILES | CCC[C@@H]1c2ccccc2CC1NC(=O)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C21H21FN2O/c1-2-5-17-16-7-4-3-6-13(16)11-19(17)24-21(25)20-12-14-10-15(22)8-9-18(14)23-20/h3-4,6-10,12,17,19,23H,2,5,11H2,1H3,(H,24,25)/t17-,19?/m1/s1 |
| InChIKey | JDYRWCZUKAEZTL-DUSLRRAJSA-N |
| XLogP | 4.55 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |