C17H20FN3O2 — CID 172664472
N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-fluoro-1H-indole-2-carboxamide (PubChem CID 172664472) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 172664472 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-5-fluoro-1H-indole-2-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H]2CNC[C@H]2C[C@@H]1O)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C17H20FN3O2/c18-12-1-2-13-9(3-12)4-15(20-13)17(23)21-14-5-10-7-19-8-11(10)6-16(14)22/h1-4,10-11,14,16,19-20,22H,5-8H2,(H,21,23)/t10-,11+,14-,16-/m0/s1 |
| InChIKey | VTOXLZGWUCPNQA-VAECKANCSA-N |
| XLogP | 1.40 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |