C24H28Cl2N2O4S — CID 143271483
2,3-dichloro-N-[(1R)-1-(1-ethoxypentan-3-yl)-2,3-dihydro-1H-inden-2-yl]-4H-thieno[3,2-b]pyrrole-5-carboxamide;formic acid (PubChem CID 143271483) has the molecular formula C24H28Cl2N2O4S and a molecular weight of 511.47 g/mol. Its IUPAC name is 2,3-dichloro-N-[(1R)-1-(1-ethoxypentan-3-yl)-2,3-dihydro-1H-inden-2-yl]-4H-thieno[3,2-b]pyrrole-5-carboxamide;formic acid.
| Compound Name | 2,3-dichloro-N-[(1R)-1-(1-ethoxypentan-3-yl)-2,3-dihydro-1H-inden-2-yl]-4H-thieno[3,2-b]pyrrole-5-carboxamide;formic acid |
|---|---|
| PubChem CID | 143271483 |
| Molecular Formula | C24H28Cl2N2O4S |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2,3-dichloro-N-[(1R)-1-(1-ethoxypentan-3-yl)-2,3-dihydro-1H-inden-2-yl]-4H-thieno[3,2-b]pyrrole-5-carboxamide;formic acid |
| SMILES | CCOCCC(CC)[C@@H]1c2ccccc2CC1NC(=O)c1cc2sc(Cl)c(Cl)c2[nH]1.O=CO |
| InChI | InChI=1S/C23H26Cl2N2O2S.CH2O2/c1-3-13(9-10-29-4-2)19-15-8-6-5-7-14(15)11-16(19)27-23(28)17-12-18-21(26-17)20(24)22(25)30-18;2-1-3/h5-8,12-13,16,19,26H,3-4,9-11H2,1-2H3,(H,27,28);1H,(H,2,3)/t13?,16?,19-;/m1./s1 |
| InChIKey | WNCNDMPHXQRKQH-LGMQYVEUSA-N |
| XLogP | 6.13 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|