C17H13Cl2N3O3S — CID 87885308
(2,3-dichloro-4H-thieno[3,2-b]pyrrol-5-yl) N-[(1S,2S)-1-formamido-2,3-dihydro-1H-inden-2-yl]carbamate (PubChem CID 87885308) has the molecular formula C17H13Cl2N3O3S and a molecular weight of 410.28 g/mol. Its IUPAC name is (2,3-dichloro-4H-thieno[3,2-b]pyrrol-5-yl) N-[(1S,2S)-1-formamido-2,3-dihydro-1H-inden-2-yl]carbamate.
| Compound Name | (2,3-dichloro-4H-thieno[3,2-b]pyrrol-5-yl) N-[(1S,2S)-1-formamido-2,3-dihydro-1H-inden-2-yl]carbamate |
|---|---|
| PubChem CID | 87885308 |
| Molecular Formula | C17H13Cl2N3O3S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | (2,3-dichloro-4H-thieno[3,2-b]pyrrol-5-yl) N-[(1S,2S)-1-formamido-2,3-dihydro-1H-inden-2-yl]carbamate |
| SMILES | O=CN[C@H]1c2ccccc2C[C@@H]1NC(=O)Oc1cc2sc(Cl)c(Cl)c2[nH]1 |
| InChI | InChI=1S/C17H13Cl2N3O3S/c18-13-15-11(26-16(13)19)6-12(22-15)25-17(24)21-10-5-8-3-1-2-4-9(8)14(10)20-7-23/h1-4,6-7,10,14,22H,5H2,(H,20,23)(H,21,24)/t10-,14-/m0/s1 |
| InChIKey | JULOYXQTJCZTLG-HZMBPMFUSA-N |
| XLogP | 4.04 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|