C25H23F3N8O3 — CID 143273197
4-N-[(1S)-3,3-difluoro-5-[[(Z)-formamidodiazenyl]-methylamino]-1,2-dihydroinden-1-yl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide (PubChem CID 143273197) has the molecular formula C25H23F3N8O3 and a molecular weight of 540.51 g/mol. Its IUPAC name is 4-N-[(1S)-3,3-difluoro-5-[[(Z)-formamidodiazenyl]-methylamino]-1,2-dihydroinden-1-yl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N-[(1S)-3,3-difluoro-5-[[(Z)-formamidodiazenyl]-methylamino]-1,2-dihydroinden-1-yl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 143273197 |
| Molecular Formula | C25H23F3N8O3 |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 4-N-[(1S)-3,3-difluoro-5-[[(Z)-formamidodiazenyl]-methylamino]-1,2-dihydroinden-1-yl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)N[C@H]3CC(F)(F)c4cc(N(C)/N=N\NC=O)ccc43)ncn2)ccc1F |
| InChI | InChI=1S/C25H23F3N8O3/c1-14-7-15(3-6-19(14)26)11-29-23(38)20-9-21(31-12-30-20)24(39)33-22-10-25(27,28)18-8-16(4-5-17(18)22)36(2)35-34-32-13-37/h3-9,12-13,22H,10-11H2,1-2H3,(H,29,38)(H,33,39)(H,32,35,37)/t22-/m0/s1 |
| InChIKey | WGRYSWWMKAMNCH-QFIPXVFZSA-N |
| XLogP | 3.29 |
| TPSA | 141.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|