C27H26FN7O2 — CID 58686187
4-N-[(1S)-5-(1,5-dimethyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide (PubChem CID 58686187) has the molecular formula C27H26FN7O2 and a molecular weight of 499.55 g/mol. Its IUPAC name is 4-N-[(1S)-5-(1,5-dimethyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 4-N-[(1S)-5-(1,5-dimethyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 58686187 |
| Molecular Formula | C27H26FN7O2 |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 4-N-[(1S)-5-(1,5-dimethyl-1,2,4-triazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-6-N-[(4-fluoro-3-methylphenyl)methyl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)N[C@H]3CCc4cc(-c5nc(C)n(C)n5)ccc43)ncn2)ccc1F |
| InChI | InChI=1S/C27H26FN7O2/c1-15-10-17(4-8-21(15)28)13-29-26(36)23-12-24(31-14-30-23)27(37)33-22-9-6-18-11-19(5-7-20(18)22)25-32-16(2)35(3)34-25/h4-5,7-8,10-12,14,22H,6,9,13H2,1-3H3,(H,29,36)(H,33,37)/t22-/m0/s1 |
| InChIKey | SHEWLWBZNJNYMP-QFIPXVFZSA-N |
| XLogP | 3.38 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |