C25H23FN8O2 — CID 58686442
2-amino-6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide (PubChem CID 58686442) has the molecular formula C25H23FN8O2 and a molecular weight of 486.51 g/mol. Its IUPAC name is 2-amino-6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 2-amino-6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 58686442 |
| Molecular Formula | C25H23FN8O2 |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-amino-6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(1S)-5-(1H-1,2,4-triazol-5-yl)-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)N[C@H]3CCc4cc(-c5ncn[nH]5)ccc43)nc(N)n2)ccc1F |
| InChI | InChI=1S/C25H23FN8O2/c1-13-8-14(2-6-18(13)26)11-28-23(35)20-10-21(33-25(27)32-20)24(36)31-19-7-4-15-9-16(3-5-17(15)19)22-29-12-30-34-22/h2-3,5-6,8-10,12,19H,4,7,11H2,1H3,(H,28,35)(H,31,36)(H2,27,32,33)(H,29,30,34)/t19-/m0/s1 |
| InChIKey | XZVGBSSNAJBKFR-IBGZPJMESA-N |
| XLogP | 2.64 |
| TPSA | 151.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |