C23H20FN7O2S — CID 58686033
6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(6S)-2-(1H-1,2,4-triazol-5-yl)-5,6-dihydro-4H-cyclopenta[b]thiophen-6-yl]pyrimidine-4,6-dicarboxamide (PubChem CID 58686033) has the molecular formula C23H20FN7O2S and a molecular weight of 477.53 g/mol. Its IUPAC name is 6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(6S)-2-(1H-1,2,4-triazol-5-yl)-5,6-dihydro-4H-cyclopenta[b]thiophen-6-yl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(6S)-2-(1H-1,2,4-triazol-5-yl)-5,6-dihydro-4H-cyclopenta[b]thiophen-6-yl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 58686033 |
| Molecular Formula | C23H20FN7O2S |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 6-N-[(4-fluoro-3-methylphenyl)methyl]-4-N-[(6S)-2-(1H-1,2,4-triazol-5-yl)-5,6-dihydro-4H-cyclopenta[b]thiophen-6-yl]pyrimidine-4,6-dicarboxamide |
| SMILES | Cc1cc(CNC(=O)c2cc(C(=O)N[C@H]3CCc4cc(-c5ncn[nH]5)sc43)ncn2)ccc1F |
| InChI | InChI=1S/C23H20FN7O2S/c1-12-6-13(2-4-15(12)24)9-25-22(32)17-8-18(27-10-26-17)23(33)30-16-5-3-14-7-19(34-20(14)16)21-28-11-29-31-21/h2,4,6-8,10-11,16H,3,5,9H2,1H3,(H,25,32)(H,30,33)(H,28,29,31)/t16-/m0/s1 |
| InChIKey | OBEFACJCSIDXQP-INIZCTEOSA-N |
| XLogP | 3.12 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |