C21H28N4O7 — CID 143273552
4-[[3-methoxy-2-[[2-methyl-6-[3-(trioxidanyl)propyl]-3-pyridinyl]amino]-4-pyridinyl]oxy]piperidine-1-carboxylic acid (PubChem CID 143273552) has the molecular formula C21H28N4O7 and a molecular weight of 448.48 g/mol. Its IUPAC name is 4-[[3-methoxy-2-[[2-methyl-6-[3-(trioxidanyl)propyl]-3-pyridinyl]amino]-4-pyridinyl]oxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[[3-methoxy-2-[[2-methyl-6-[3-(trioxidanyl)propyl]-3-pyridinyl]amino]-4-pyridinyl]oxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 143273552 |
| Molecular Formula | C21H28N4O7 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 4-[[3-methoxy-2-[[2-methyl-6-[3-(trioxidanyl)propyl]-3-pyridinyl]amino]-4-pyridinyl]oxy]piperidine-1-carboxylic acid |
| SMILES | COc1c(OC2CCN(C(=O)O)CC2)ccnc1Nc1ccc(CCCOOO)nc1C |
| InChI | InChI=1S/C21H28N4O7/c1-14-17(6-5-15(23-14)4-3-13-30-32-28)24-20-19(29-2)18(7-10-22-20)31-16-8-11-25(12-9-16)21(26)27/h5-7,10,16,28H,3-4,8-9,11-13H2,1-2H3,(H,22,24)(H,26,27) |
| InChIKey | WFYRTPMHRADKIM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 135.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|