C24H33N3O4 — CID 143273736
acetic acid;N-[(Z)-[1-amino-4-(4-propan-2-yloxyphenyl)butylidene]amino]-N-[(4-methylphenyl)methyl]formamide (PubChem CID 143273736) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is acetic acid;N-[(Z)-[1-amino-4-(4-propan-2-yloxyphenyl)butylidene]amino]-N-[(4-methylphenyl)methyl]formamide.
| Compound Name | acetic acid;N-[(Z)-[1-amino-4-(4-propan-2-yloxyphenyl)butylidene]amino]-N-[(4-methylphenyl)methyl]formamide |
|---|---|
| PubChem CID | 143273736 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | acetic acid;N-[(Z)-[1-amino-4-(4-propan-2-yloxyphenyl)butylidene]amino]-N-[(4-methylphenyl)methyl]formamide |
| SMILES | CC(=O)O.Cc1ccc(CN(C=O)/N=C(\N)CCCc2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O2.C2H4O2/c1-17(2)27-21-13-11-19(12-14-21)5-4-6-22(23)24-25(16-26)15-20-9-7-18(3)8-10-20;1-2(3)4/h7-14,16-17H,4-6,15H2,1-3H3,(H2,23,24);1H3,(H,3,4) |
| InChIKey | NHHQCWAEPPRLMZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|