C7H12N2 — CID 143274176
4,5-dimethylidene-1H-imidazole;ethane (PubChem CID 143274176) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 4,5-dimethylidene-1H-imidazole;ethane.
| Compound Name | 4,5-dimethylidene-1H-imidazole;ethane |
|---|---|
| PubChem CID | 143274176 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 4,5-dimethylidene-1H-imidazole;ethane |
| SMILES | C=c1nc[nH]c1=C.CC |
| InChI | InChI=1S/C5H6N2.C2H6/c1-4-5(2)7-3-6-4;1-2/h3H,1-2H2,(H,6,7);1-2H3 |
| InChIKey | OOCWMKQZXCCKJN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |