C6H8N2 — CID 123744878
1-methyl-4,5-dimethylideneimidazole (PubChem CID 123744878) has the molecular formula C6H8N2 and a molecular weight of 108.14 g/mol. Its IUPAC name is 1-methyl-4,5-dimethylideneimidazole.
| Compound Name | 1-methyl-4,5-dimethylideneimidazole |
|---|---|
| PubChem CID | 123744878 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 1-methyl-4,5-dimethylideneimidazole |
| SMILES | C=c1ncn(C)c1=C |
| InChI | InChI=1S/C6H8N2/c1-5-6(2)8(3)4-7-5/h4H,1-2H2,3H3 |
| InChIKey | AKBXNBHVNAXPDE-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |