About 1-(fluoromethyl)-4,5-dimethylideneimidazole
1-(fluoromethyl)-4,5-dimethylideneimidazole (PubChem CID 123863810) has the molecular formula C6H7FN2
and a molecular weight of 126.13 g/mol. Its IUPAC name is 1-(fluoromethyl)-4,5-dimethylideneimidazole.
Molecular Properties
| Compound Name | 1-(fluoromethyl)-4,5-dimethylideneimidazole |
| PubChem CID | 123863810 |
| Molecular Formula | C6H7FN2 |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | 1-(fluoromethyl)-4,5-dimethylideneimidazole |
| SMILES | C=c1ncn(CF)c1=C |
| InChI | InChI=1S/C6H7FN2/c1-5-6(2)9(3-7)4-8-5/h4H,1-3H2 |
| InChIKey | MOKURWUEALRITN-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(fluoromethyl)-4,5-dimethylideneimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(fluoromethyl)-4,5-dimethylideneimidazole?
The IUPAC name of 1-(fluoromethyl)-4,5-dimethylideneimidazole (CID 123863810) is 1-(fluoromethyl)-4,5-dimethylideneimidazole.
What is the SMILES notation for 1-(fluoromethyl)-4,5-dimethylideneimidazole?
The canonical SMILES for 1-(fluoromethyl)-4,5-dimethylideneimidazole is C=c1ncn(CF)c1=C.
What is the InChIKey of 1-(fluoromethyl)-4,5-dimethylideneimidazole?
The InChIKey is MOKURWUEALRITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2/c1-5-6(2)9(3-7)4-8-5/h4H,1-3H2.
What are the key properties of 1-(fluoromethyl)-4,5-dimethylideneimidazole?
1-(fluoromethyl)-4,5-dimethylideneimidazole has a molecular weight of 126.13 g/mol, XLogP of -0.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(fluoromethyl)-4,5-dimethylideneimidazole is sourced from PubChem (CID 123863810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).