C5H7N2+ — CID 171750085
3-methylidene-5-(113C)methylidene-(2,4,5-13C3)4H-imidazol-3-ium (PubChem CID 171750085) has the molecular formula C5H7N2+ and a molecular weight of 99.09 g/mol. Its IUPAC name is 3-methylidene-5-(113C)methylidene-(2,4,5-13C3)4H-imidazol-3-ium.
| Compound Name | 3-methylidene-5-(113C)methylidene-(2,4,5-13C3)4H-imidazol-3-ium |
|---|---|
| PubChem CID | 171750085 |
| Molecular Formula | C5H7N2+ |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | 3-methylidene-5-(113C)methylidene-(2,4,5-13C3)4H-imidazol-3-ium |
| SMILES | C=[N+]1[13CH]=N[13C](=[13CH2])[13CH2]1 |
| InChI | InChI=1S/C5H7N2/c1-5-3-7(2)4-6-5/h4H,1-3H2/q+1/i1+1,3+1,4+1,5+1 |
| InChIKey | OKJUUIRWKLIZJR-NDYLVSJFSA-N |
| XLogP | 0.26 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|