C20H30N4O3S — CID 143274498
5-ethyl-N-methyl-6-(2-phenylethyl)pyrimidin-4-amine;2-(sulfinamoyloxymethyl)oxolane (PubChem CID 143274498) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is 5-ethyl-N-methyl-6-(2-phenylethyl)pyrimidin-4-amine;2-(sulfinamoyloxymethyl)oxolane.
| Compound Name | 5-ethyl-N-methyl-6-(2-phenylethyl)pyrimidin-4-amine;2-(sulfinamoyloxymethyl)oxolane |
|---|---|
| PubChem CID | 143274498 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 5-ethyl-N-methyl-6-(2-phenylethyl)pyrimidin-4-amine;2-(sulfinamoyloxymethyl)oxolane |
| SMILES | CCc1c(CCc2ccccc2)ncnc1NC.NS(=O)OCC1CCCO1 |
| InChI | InChI=1S/C15H19N3.C5H11NO3S/c1-3-13-14(17-11-18-15(13)16-2)10-9-12-7-5-4-6-8-12;6-10(7)9-4-5-2-1-3-8-5/h4-8,11H,3,9-10H2,1-2H3,(H,16,17,18);5H,1-4,6H2 |
| InChIKey | QCFJNPYSGNMUAY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |