C33H53F2N5 — CID 143279910
(4Z)-6-[4-[1-[(2E)-6-fluoro-2-methylhepta-2,4-dienyl]piperidin-4-yl]piperazin-1-yl]-N-[(2E,4E)-5-fluoro-2-methylhexa-2,4-dienyl]-3,5-dimethyl-6-methyliminohexa-1,4-dien-2-amine (PubChem CID 143279910) has the molecular formula C33H53F2N5 and a molecular weight of 557.82 g/mol. Its IUPAC name is (4Z)-6-[4-[1-[(2E)-6-fluoro-2-methylhepta-2,4-dienyl]piperidin-4-yl]piperazin-1-yl]-N-[(2E,4E)-5-fluoro-2-methylhexa-2,4-dienyl]-3,5-dimethyl-6-methyliminohexa-1,4-dien-2-amine.
| Compound Name | (4Z)-6-[4-[1-[(2E)-6-fluoro-2-methylhepta-2,4-dienyl]piperidin-4-yl]piperazin-1-yl]-N-[(2E,4E)-5-fluoro-2-methylhexa-2,4-dienyl]-3,5-dimethyl-6-methyliminohexa-1,4-dien-2-amine |
|---|---|
| PubChem CID | 143279910 |
| Molecular Formula | C33H53F2N5 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.43 |
| IUPAC Name | (4Z)-6-[4-[1-[(2E)-6-fluoro-2-methylhepta-2,4-dienyl]piperidin-4-yl]piperazin-1-yl]-N-[(2E,4E)-5-fluoro-2-methylhexa-2,4-dienyl]-3,5-dimethyl-6-methyliminohexa-1,4-dien-2-amine |
| SMILES | C=C(NC/C(C)=C/C=C(\C)F)C(C)/C=C(C)\C(=N\C)N1CCN(C2CCN(C/C(C)=C/C=CC(C)F)CC2)CC1 |
| InChI | InChI=1S/C33H53F2N5/c1-25(12-13-30(6)35)23-37-31(7)27(3)22-28(4)33(36-8)40-20-18-39(19-21-40)32-14-16-38(17-15-32)24-26(2)10-9-11-29(5)34/h9-13,22,27,29,32,37H,7,14-21,23-24H2,1-6,8H3/b11-9?,25-12+,26-10+,28-22-,30-13+,36-33- |
| InChIKey | FJOMAUHWXQQUEB-KBCAJPHGSA-N |
| XLogP | 6.46 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|