C26H38F3N3 — CID 178040178
N',2-dimethyl-N-[(2Z)-1-methyl-2-[(3Z,5Z)-3-[(Z)-prop-1-enyl]-5-(trifluoromethyl)octa-3,5-dienylidene]piperidin-3-yl]cyclopentene-1-carboximidamide (PubChem CID 178040178) has the molecular formula C26H38F3N3 and a molecular weight of 449.61 g/mol. Its IUPAC name is N',2-dimethyl-N-[(2Z)-1-methyl-2-[(3Z,5Z)-3-[(Z)-prop-1-enyl]-5-(trifluoromethyl)octa-3,5-dienylidene]piperidin-3-yl]cyclopentene-1-carboximidamide.
| Compound Name | N',2-dimethyl-N-[(2Z)-1-methyl-2-[(3Z,5Z)-3-[(Z)-prop-1-enyl]-5-(trifluoromethyl)octa-3,5-dienylidene]piperidin-3-yl]cyclopentene-1-carboximidamide |
|---|---|
| PubChem CID | 178040178 |
| Molecular Formula | C26H38F3N3 |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | N',2-dimethyl-N-[(2Z)-1-methyl-2-[(3Z,5Z)-3-[(Z)-prop-1-enyl]-5-(trifluoromethyl)octa-3,5-dienylidene]piperidin-3-yl]cyclopentene-1-carboximidamide |
| SMILES | C/C=C\C(=C/C(=C/CC)C(F)(F)F)C/C=C1/C(N/C(=N/C)C2=C(C)CCC2)CCCN1C |
| InChI | InChI=1S/C26H38F3N3/c1-6-10-20(18-21(11-7-2)26(27,28)29)15-16-24-23(14-9-17-32(24)5)31-25(30-4)22-13-8-12-19(22)3/h6,10-11,16,18,23H,7-9,12-15,17H2,1-5H3,(H,30,31)/b10-6-,20-18+,21-11-,24-16- |
| InChIKey | URXBLXWJPCNVLU-WJUULNDKSA-N |
| XLogP | 6.87 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|