C24H36F3N3 — CID 156640751
N'-[4-ethenyl-1-[(4R)-2-methylheptan-4-yl]-2,5-dihydropyrrol-3-yl]-N-[(3Z)-7,7,7-trifluoro-5-methylidenehepta-1,3-dien-2-yl]ethanimidamide (PubChem CID 156640751) has the molecular formula C24H36F3N3 and a molecular weight of 423.57 g/mol. Its IUPAC name is N'-[4-ethenyl-1-[(4R)-2-methylheptan-4-yl]-2,5-dihydropyrrol-3-yl]-N-[(3Z)-7,7,7-trifluoro-5-methylidenehepta-1,3-dien-2-yl]ethanimidamide.
| Compound Name | N'-[4-ethenyl-1-[(4R)-2-methylheptan-4-yl]-2,5-dihydropyrrol-3-yl]-N-[(3Z)-7,7,7-trifluoro-5-methylidenehepta-1,3-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 156640751 |
| Molecular Formula | C24H36F3N3 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N'-[4-ethenyl-1-[(4R)-2-methylheptan-4-yl]-2,5-dihydropyrrol-3-yl]-N-[(3Z)-7,7,7-trifluoro-5-methylidenehepta-1,3-dien-2-yl]ethanimidamide |
| SMILES | C=CC1=C(/N=C(\C)NC(=C)/C=C\C(=C)CC(F)(F)F)CN([C@H](CCC)CC(C)C)C1 |
| InChI | InChI=1S/C24H36F3N3/c1-8-10-22(13-17(3)4)30-15-21(9-2)23(16-30)29-20(7)28-19(6)12-11-18(5)14-24(25,26)27/h9,11-12,17,22H,2,5-6,8,10,13-16H2,1,3-4,7H3,(H,28,29)/b12-11-/t22-/m1/s1 |
| InChIKey | DFMOBEGETLTIRW-SSSWZJSRSA-N |
| XLogP | 6.54 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|