C24H42F2N4 — CID 144818247
N'-cyclohexyl-2-ethyl-4-methyl-N-prop-1-en-2-yl-3H-pyrrole-5-carboximidamide;4,4-difluoropiperidine;ethane (PubChem CID 144818247) has the molecular formula C24H42F2N4 and a molecular weight of 424.62 g/mol. Its IUPAC name is N'-cyclohexyl-2-ethyl-4-methyl-N-prop-1-en-2-yl-3H-pyrrole-5-carboximidamide;4,4-difluoropiperidine;ethane.
| Compound Name | N'-cyclohexyl-2-ethyl-4-methyl-N-prop-1-en-2-yl-3H-pyrrole-5-carboximidamide;4,4-difluoropiperidine;ethane |
|---|---|
| PubChem CID | 144818247 |
| Molecular Formula | C24H42F2N4 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | N'-cyclohexyl-2-ethyl-4-methyl-N-prop-1-en-2-yl-3H-pyrrole-5-carboximidamide;4,4-difluoropiperidine;ethane |
| SMILES | C=C(C)N/C(=N\C1CCCCC1)C1=C(C)CC(CC)=N1.CC.FC1(F)CCNCC1 |
| InChI | InChI=1S/C17H27N3.C5H9F2N.C2H6/c1-5-14-11-13(4)16(19-14)17(18-12(2)3)20-15-9-7-6-8-10-15;6-5(7)1-3-8-4-2-5;1-2/h15H,2,5-11H2,1,3-4H3,(H,18,20);8H,1-4H2;1-2H3 |
| InChIKey | ZOWYHFHAZQCBDW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|