C28H33N3O2 — CID 143281099
2,3-dihydroindol-1-yl-[3-[[4-[(3Z)-4-ethoxyhexa-1,3,5-trien-3-yl]piperazin-1-yl]methyl]phenyl]methanone (PubChem CID 143281099) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[3-[[4-[(3Z)-4-ethoxyhexa-1,3,5-trien-3-yl]piperazin-1-yl]methyl]phenyl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[3-[[4-[(3Z)-4-ethoxyhexa-1,3,5-trien-3-yl]piperazin-1-yl]methyl]phenyl]methanone |
|---|---|
| PubChem CID | 143281099 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[3-[[4-[(3Z)-4-ethoxyhexa-1,3,5-trien-3-yl]piperazin-1-yl]methyl]phenyl]methanone |
| SMILES | C=C/C(OCC)=C(\C=C)N1CCN(Cc2cccc(C(=O)N3CCc4ccccc43)c2)CC1 |
| InChI | InChI=1S/C28H33N3O2/c1-4-25(27(5-2)33-6-3)30-18-16-29(17-19-30)21-22-10-9-12-24(20-22)28(32)31-15-14-23-11-7-8-13-26(23)31/h4-5,7-13,20H,1-2,6,14-19,21H2,3H3/b27-25- |
| InChIKey | FFAAQFZKBJEASZ-RFBIWTDZSA-N |
| XLogP | 4.63 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|