C23H35N3O2S — CID 143281736
4-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-2-(4-propoxyphenyl)-4,5-dihydro-1,3-thiazole-5-carboxamide (PubChem CID 143281736) has the molecular formula C23H35N3O2S and a molecular weight of 417.62 g/mol. Its IUPAC name is 4-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-2-(4-propoxyphenyl)-4,5-dihydro-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-2-(4-propoxyphenyl)-4,5-dihydro-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 143281736 |
| Molecular Formula | C23H35N3O2S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 4-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-2-(4-propoxyphenyl)-4,5-dihydro-1,3-thiazole-5-carboxamide |
| SMILES | CCCOc1ccc(C2=NC(C)C(C(=O)NCCCN3CCCCC3C)S2)cc1 |
| InChI | InChI=1S/C23H35N3O2S/c1-4-16-28-20-11-9-19(10-12-20)23-25-18(3)21(29-23)22(27)24-13-7-15-26-14-6-5-8-17(26)2/h9-12,17-18,21H,4-8,13-16H2,1-3H3,(H,24,27) |
| InChIKey | UPTHSYHLHYQSCB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|