C26H27ClF6N2O — CID 143282269
2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-chloro-4-[(3E,5Z)-2-methylhepta-3,5-dien-3-yl]-3-pyridinyl]-N,2-dimethylpropanamide (PubChem CID 143282269) has the molecular formula C26H27ClF6N2O and a molecular weight of 532.96 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-chloro-4-[(3E,5Z)-2-methylhepta-3,5-dien-3-yl]-3-pyridinyl]-N,2-dimethylpropanamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-chloro-4-[(3E,5Z)-2-methylhepta-3,5-dien-3-yl]-3-pyridinyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 143282269 |
| Molecular Formula | C26H27ClF6N2O |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-[6-chloro-4-[(3E,5Z)-2-methylhepta-3,5-dien-3-yl]-3-pyridinyl]-N,2-dimethylpropanamide |
| SMILES | C/C=C\C=C(\c1cc(Cl)ncc1N(C)C(=O)C(C)(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C26H27ClF6N2O/c1-7-8-9-19(15(2)3)20-13-22(27)34-14-21(20)35(6)23(36)24(4,5)16-10-17(25(28,29)30)12-18(11-16)26(31,32)33/h7-15H,1-6H3/b8-7-,19-9+ |
| InChIKey | CNDCQFMNOSYNQW-ZPQONNSUSA-N |
| XLogP | 8.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|